About ethane;methoxy-dimethyl-trimethylsilylsilane
ethane;methoxy-dimethyl-trimethylsilylsilane (PubChem CID 174884678) has the molecular formula C8H24OSi2
and a molecular weight of 192.45 g/mol. Its IUPAC name is ethane;methoxy-dimethyl-trimethylsilylsilane.
Molecular Properties
| Compound Name | ethane;methoxy-dimethyl-trimethylsilylsilane |
| PubChem CID | 174884678 |
| Molecular Formula | C8H24OSi2 |
| Molecular Weight | 192.45 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | ethane;methoxy-dimethyl-trimethylsilylsilane |
| SMILES | CC.CO[Si](C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C6H18OSi2.C2H6/c1-7-9(5,6)8(2,3)4;1-2/h1-6H3;1-2H3 |
| InChIKey | ANZJCHIKMYJZCR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;methoxy-dimethyl-trimethylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxy-dimethyl-trimethylsilylsilane?
The IUPAC name of ethane;methoxy-dimethyl-trimethylsilylsilane (CID 174884678) is ethane;methoxy-dimethyl-trimethylsilylsilane.
What is the SMILES notation for ethane;methoxy-dimethyl-trimethylsilylsilane?
The canonical SMILES for ethane;methoxy-dimethyl-trimethylsilylsilane is CC.CO[Si](C)(C)[Si](C)(C)C.
What is the InChIKey of ethane;methoxy-dimethyl-trimethylsilylsilane?
The InChIKey is ANZJCHIKMYJZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18OSi2.C2H6/c1-7-9(5,6)8(2,3)4;1-2/h1-6H3;1-2H3.
What are the key properties of ethane;methoxy-dimethyl-trimethylsilylsilane?
ethane;methoxy-dimethyl-trimethylsilylsilane has a molecular weight of 192.45 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxy-dimethyl-trimethylsilylsilane is sourced from PubChem (CID 174884678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).