About dodecanamide;2-hydroxy-N-phenylbenzamide
dodecanamide;2-hydroxy-N-phenylbenzamide (PubChem CID 174887161) has the molecular formula C25H36N2O3
and a molecular weight of 412.57 g/mol. Its IUPAC name is dodecanamide;2-hydroxy-N-phenylbenzamide.
Molecular Properties
| Compound Name | dodecanamide;2-hydroxy-N-phenylbenzamide |
| PubChem CID | 174887161 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | dodecanamide;2-hydroxy-N-phenylbenzamide |
| SMILES | CCCCCCCCCCCC(N)=O.O=C(Nc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C13H11NO2.C12H25NO/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10;1-2-3-4-5-6-7-8-9-10-11-12(13)14/h1-9,15H,(H,14,16);2-11H2,1H3,(H2,13,14) |
| InChIKey | MDFPBHYPZYRQAB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecanamide;2-hydroxy-N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanamide;2-hydroxy-N-phenylbenzamide?
The IUPAC name of dodecanamide;2-hydroxy-N-phenylbenzamide (CID 174887161) is dodecanamide;2-hydroxy-N-phenylbenzamide.
What is the SMILES notation for dodecanamide;2-hydroxy-N-phenylbenzamide?
The canonical SMILES for dodecanamide;2-hydroxy-N-phenylbenzamide is CCCCCCCCCCCC(N)=O.O=C(Nc1ccccc1)c1ccccc1O.
What is the InChIKey of dodecanamide;2-hydroxy-N-phenylbenzamide?
The InChIKey is MDFPBHYPZYRQAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2.C12H25NO/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10;1-2-3-4-5-6-7-8-9-10-11-12(13)14/h1-9,15H,(H,14,16);2-11H2,1H3,(H2,13,14).
What are the key properties of dodecanamide;2-hydroxy-N-phenylbenzamide?
dodecanamide;2-hydroxy-N-phenylbenzamide has a molecular weight of 412.57 g/mol, XLogP of 6.04, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanamide;2-hydroxy-N-phenylbenzamide is sourced from PubChem (CID 174887161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).