C22H26N4O2 — CID 17488732
2-[(2-methyl-1,3-benzoxazol-5-yl)amino]-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 17488732) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-benzoxazol-5-yl)amino]-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | 2-[(2-methyl-1,3-benzoxazol-5-yl)amino]-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 17488732 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-[(2-methyl-1,3-benzoxazol-5-yl)amino]-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | Cc1nc2cc(NC(C)C(=O)Nc3ccc(N4CCCCC4)cc3)ccc2o1 |
| InChI | InChI=1S/C22H26N4O2/c1-15(23-18-8-11-21-20(14-18)24-16(2)28-21)22(27)25-17-6-9-19(10-7-17)26-12-4-3-5-13-26/h6-11,14-15,23H,3-5,12-13H2,1-2H3,(H,25,27) |
| InChIKey | BLQUOATVOJUPAZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|