C17H16N4O4 — CID 25473815
(2R)-2-[(2-methyl-1,3-benzoxazol-5-yl)amino]-N-(3-nitrophenyl)propanamide (PubChem CID 25473815) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is (2R)-2-[(2-methyl-1,3-benzoxazol-5-yl)amino]-N-(3-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[(2-methyl-1,3-benzoxazol-5-yl)amino]-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 25473815 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (2R)-2-[(2-methyl-1,3-benzoxazol-5-yl)amino]-N-(3-nitrophenyl)propanamide |
| SMILES | Cc1nc2cc(N[C@H](C)C(=O)Nc3cccc([N+](=O)[O-])c3)ccc2o1 |
| InChI | InChI=1S/C17H16N4O4/c1-10(17(22)20-12-4-3-5-14(8-12)21(23)24)18-13-6-7-16-15(9-13)19-11(2)25-16/h3-10,18H,1-2H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | NLSOAXMDHOPQKX-SNVBAGLBSA-N |
| XLogP | 3.48 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|