C16H15BrO4 — CID 174889468
1-[2-(bromomethyl)phenyl]-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174889468) has the molecular formula C16H15BrO4 and a molecular weight of 351.20 g/mol. Its IUPAC name is 1-[2-(bromomethyl)phenyl]-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-[2-(bromomethyl)phenyl]-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174889468 |
| Molecular Formula | C16H15BrO4 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 1-[2-(bromomethyl)phenyl]-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)CC(C(=O)O)(c2ccccc2CBr)C=C1 |
| InChI | InChI=1S/C16H15BrO4/c1-10-6-7-16(15(20)21,8-12(10)14(18)19)13-5-3-2-4-11(13)9-17/h2-7H,8-9H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | KFILXUGIGWCBBA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|