About disilanyl(silyl)silane;methane
disilanyl(silyl)silane;methane (PubChem CID 174890632) has the molecular formula CH14Si4
and a molecular weight of 138.47 g/mol. Its IUPAC name is disilanyl(silyl)silane;methane.
Molecular Properties
| Compound Name | disilanyl(silyl)silane;methane |
| PubChem CID | 174890632 |
| Molecular Formula | CH14Si4 |
| Molecular Weight | 138.47 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | disilanyl(silyl)silane;methane |
| SMILES | C.[SiH3][SiH2][SiH2][SiH3] |
| InChI | InChI=1S/CH4.H10Si4/c;1-3-4-2/h1H4;3-4H2,1-2H3 |
| InChIKey | CHXYLLFHFFTLPE-UHFFFAOYSA-N |
| XLogP | -3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.47 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze disilanyl(silyl)silane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disilanyl(silyl)silane;methane?
The IUPAC name of disilanyl(silyl)silane;methane (CID 174890632) is disilanyl(silyl)silane;methane.
What is the SMILES notation for disilanyl(silyl)silane;methane?
The canonical SMILES for disilanyl(silyl)silane;methane is C.[SiH3][SiH2][SiH2][SiH3].
What is the InChIKey of disilanyl(silyl)silane;methane?
The InChIKey is CHXYLLFHFFTLPE-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4.H10Si4/c;1-3-4-2/h1H4;3-4H2,1-2H3.
What are the key properties of disilanyl(silyl)silane;methane?
disilanyl(silyl)silane;methane has a molecular weight of 138.47 g/mol, XLogP of -3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for disilanyl(silyl)silane;methane is sourced from PubChem (CID 174890632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).