About disilanyl(hydroxy)silane;trihydroxy(methoxy)silane
disilanyl(hydroxy)silane;trihydroxy(methoxy)silane (PubChem CID 175077163) has the molecular formula CH14O5Si4
and a molecular weight of 218.46 g/mol. Its IUPAC name is disilanyl(hydroxy)silane;trihydroxy(methoxy)silane.
Molecular Properties
| Compound Name | disilanyl(hydroxy)silane;trihydroxy(methoxy)silane |
| PubChem CID | 175077163 |
| Molecular Formula | CH14O5Si4 |
| Molecular Weight | 218.46 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | disilanyl(hydroxy)silane;trihydroxy(methoxy)silane |
| SMILES | CO[Si](O)(O)O.O[SiH2][SiH2][SiH3] |
| InChI | InChI=1S/CH6O4Si.H8OSi3/c1-5-6(2,3)4;1-3-4-2/h2-4H,1H3;1H,3-4H2,2H3 |
| InChIKey | NFUMUTGPRHHYRJ-UHFFFAOYSA-N |
| XLogP | -5.53 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.46 |
| LogP ≤ 5 | -5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze disilanyl(hydroxy)silane;trihydroxy(methoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disilanyl(hydroxy)silane;trihydroxy(methoxy)silane?
The IUPAC name of disilanyl(hydroxy)silane;trihydroxy(methoxy)silane (CID 175077163) is disilanyl(hydroxy)silane;trihydroxy(methoxy)silane.
What is the SMILES notation for disilanyl(hydroxy)silane;trihydroxy(methoxy)silane?
The canonical SMILES for disilanyl(hydroxy)silane;trihydroxy(methoxy)silane is CO[Si](O)(O)O.O[SiH2][SiH2][SiH3].
What is the InChIKey of disilanyl(hydroxy)silane;trihydroxy(methoxy)silane?
The InChIKey is NFUMUTGPRHHYRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH6O4Si.H8OSi3/c1-5-6(2,3)4;1-3-4-2/h2-4H,1H3;1H,3-4H2,2H3.
What are the key properties of disilanyl(hydroxy)silane;trihydroxy(methoxy)silane?
disilanyl(hydroxy)silane;trihydroxy(methoxy)silane has a molecular weight of 218.46 g/mol, XLogP of -5.53, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disilanyl(hydroxy)silane;trihydroxy(methoxy)silane is sourced from PubChem (CID 175077163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).