About silicic acid;trihydroxy(methoxy)silane
silicic acid;trihydroxy(methoxy)silane (PubChem CID 174854052) has the molecular formula CH10O8Si2
and a molecular weight of 206.25 g/mol. Its IUPAC name is silicic acid;trihydroxy(methoxy)silane.
Molecular Properties
| Compound Name | silicic acid;trihydroxy(methoxy)silane |
| PubChem CID | 174854052 |
| Molecular Formula | CH10O8Si2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | silicic acid;trihydroxy(methoxy)silane |
| SMILES | CO[Si](O)(O)O.O[Si](O)(O)O |
| InChI | InChI=1S/CH6O4Si.H4O4Si/c1-5-6(2,3)4;1-5(2,3)4/h2-4H,1H3;1-4H |
| InChIKey | WZRJOFKQRIMXHZ-UHFFFAOYSA-N |
| XLogP | -4.56 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silicic acid;trihydroxy(methoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silicic acid;trihydroxy(methoxy)silane?
The IUPAC name of silicic acid;trihydroxy(methoxy)silane (CID 174854052) is silicic acid;trihydroxy(methoxy)silane.
What is the SMILES notation for silicic acid;trihydroxy(methoxy)silane?
The canonical SMILES for silicic acid;trihydroxy(methoxy)silane is CO[Si](O)(O)O.O[Si](O)(O)O.
What is the InChIKey of silicic acid;trihydroxy(methoxy)silane?
The InChIKey is WZRJOFKQRIMXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH6O4Si.H4O4Si/c1-5-6(2,3)4;1-5(2,3)4/h2-4H,1H3;1-4H.
What are the key properties of silicic acid;trihydroxy(methoxy)silane?
silicic acid;trihydroxy(methoxy)silane has a molecular weight of 206.25 g/mol, XLogP of -4.56, 1 rotatable bonds, 7 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for silicic acid;trihydroxy(methoxy)silane is sourced from PubChem (CID 174854052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).