C18H17NO5 — CID 174894459
2-[[1-(3,4-dimethoxyphenyl)-3-oxopropan-2-ylidene]amino]benzoic acid (PubChem CID 174894459) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[[1-(3,4-dimethoxyphenyl)-3-oxopropan-2-ylidene]amino]benzoic acid.
| Compound Name | 2-[[1-(3,4-dimethoxyphenyl)-3-oxopropan-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 174894459 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[[1-(3,4-dimethoxyphenyl)-3-oxopropan-2-ylidene]amino]benzoic acid |
| SMILES | COc1ccc(C/C(C=O)=N/c2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H17NO5/c1-23-16-8-7-12(10-17(16)24-2)9-13(11-20)19-15-6-4-3-5-14(15)18(21)22/h3-8,10-11H,9H2,1-2H3,(H,21,22)/b19-13- |
| InChIKey | NSASEANQCJWNEI-UYRXBGFRSA-N |
| XLogP | 2.92 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|