C18H17NO5 — CID 176520584
2-[[3-(3,4-dimethoxyphenyl)-1-oxoprop-1-en-2-yl]amino]benzoic acid (PubChem CID 176520584) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[[3-(3,4-dimethoxyphenyl)-1-oxoprop-1-en-2-yl]amino]benzoic acid.
| Compound Name | 2-[[3-(3,4-dimethoxyphenyl)-1-oxoprop-1-en-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 176520584 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[[3-(3,4-dimethoxyphenyl)-1-oxoprop-1-en-2-yl]amino]benzoic acid |
| SMILES | COc1ccc(CC(=C=O)Nc2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H17NO5/c1-23-16-8-7-12(10-17(16)24-2)9-13(11-20)19-15-6-4-3-5-14(15)18(21)22/h3-8,10,19H,9H2,1-2H3,(H,21,22) |
| InChIKey | PZTOPWUJOKYVAE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|