C20H24N4O4S — CID 174900492
2-benzyl-N-[[4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 174900492) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-benzyl-N-[[4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide.
| Compound Name | 2-benzyl-N-[[4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 174900492 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-benzyl-N-[[4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | NNC(=O)c1ccc(CNC(=O)N2CCS(=O)(=O)C(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H24N4O4S/c21-23-19(25)17-8-6-16(7-9-17)13-22-20(26)24-10-11-29(27,28)18(14-24)12-15-4-2-1-3-5-15/h1-9,18H,10-14,21H2,(H,22,26)(H,23,25) |
| InChIKey | PWAVRHZEWUUVAM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|