C12H24N2O6 — CID 174901428
2-amino-3-methylpentanoic acid;2-(3-hydroxybutanoylamino)acetic acid (PubChem CID 174901428) has the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-amino-3-methylpentanoic acid;2-(3-hydroxybutanoylamino)acetic acid.
| Compound Name | 2-amino-3-methylpentanoic acid;2-(3-hydroxybutanoylamino)acetic acid |
|---|---|
| PubChem CID | 174901428 |
| Molecular Formula | C12H24N2O6 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-amino-3-methylpentanoic acid;2-(3-hydroxybutanoylamino)acetic acid |
| SMILES | CC(O)CC(=O)NCC(=O)O.CCC(C)C(N)C(=O)O |
| InChI | InChI=1S/C6H11NO4.C6H13NO2/c1-4(8)2-5(9)7-3-6(10)11;1-3-4(2)5(7)6(8)9/h4,8H,2-3H2,1H3,(H,7,9)(H,10,11);4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | YDBPDSNFGZTYBT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |