About octane-1-sulfonamide;oxido(propyl)azanium
octane-1-sulfonamide;oxido(propyl)azanium (PubChem CID 174903054) has the molecular formula C11H28N2O3S
and a molecular weight of 268.42 g/mol. Its IUPAC name is octane-1-sulfonamide;oxido(propyl)azanium.
Molecular Properties
| Compound Name | octane-1-sulfonamide;oxido(propyl)azanium |
| PubChem CID | 174903054 |
| Molecular Formula | C11H28N2O3S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | octane-1-sulfonamide;oxido(propyl)azanium |
| SMILES | CCCCCCCCS(N)(=O)=O.CCC[NH2+][O-] |
| InChI | InChI=1S/C8H19NO2S.C3H9NO/c1-2-3-4-5-6-7-8-12(9,10)11;1-2-3-4-5/h2-8H2,1H3,(H2,9,10,11);2-4H2,1H3 |
| InChIKey | WRZYDUMVKRUGBO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze octane-1-sulfonamide;oxido(propyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-1-sulfonamide;oxido(propyl)azanium?
The IUPAC name of octane-1-sulfonamide;oxido(propyl)azanium (CID 174903054) is octane-1-sulfonamide;oxido(propyl)azanium.
What is the SMILES notation for octane-1-sulfonamide;oxido(propyl)azanium?
The canonical SMILES for octane-1-sulfonamide;oxido(propyl)azanium is CCCCCCCCS(N)(=O)=O.CCC[NH2+][O-].
What is the InChIKey of octane-1-sulfonamide;oxido(propyl)azanium?
The InChIKey is WRZYDUMVKRUGBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2S.C3H9NO/c1-2-3-4-5-6-7-8-12(9,10)11;1-2-3-4-5/h2-8H2,1H3,(H2,9,10,11);2-4H2,1H3.
What are the key properties of octane-1-sulfonamide;oxido(propyl)azanium?
octane-1-sulfonamide;oxido(propyl)azanium has a molecular weight of 268.42 g/mol, XLogP of 1.09, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octane-1-sulfonamide;oxido(propyl)azanium is sourced from PubChem (CID 174903054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).