C16H18BrN3O2 — CID 17490617
5-bromo-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]pyridine-3-carboxamide (PubChem CID 17490617) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is 5-bromo-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17490617 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 5-bromo-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC(c1ccco1)N1CCCC1)c1cncc(Br)c1 |
| InChI | InChI=1S/C16H18BrN3O2/c17-13-8-12(9-18-10-13)16(21)19-11-14(15-4-3-7-22-15)20-5-1-2-6-20/h3-4,7-10,14H,1-2,5-6,11H2,(H,19,21) |
| InChIKey | PEPHYKWATJOXAQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |