C13H22BFO5 — CID 174908128
boric acid;4-fluoro-2,3-dimethyl-3-phenylmethoxybutan-2-ol (PubChem CID 174908128) has the molecular formula C13H22BFO5 and a molecular weight of 288.12 g/mol. Its IUPAC name is boric acid;4-fluoro-2,3-dimethyl-3-phenylmethoxybutan-2-ol.
| Compound Name | boric acid;4-fluoro-2,3-dimethyl-3-phenylmethoxybutan-2-ol |
|---|---|
| PubChem CID | 174908128 |
| Molecular Formula | C13H22BFO5 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | boric acid;4-fluoro-2,3-dimethyl-3-phenylmethoxybutan-2-ol |
| SMILES | CC(C)(O)C(C)(CF)OCc1ccccc1.OB(O)O |
| InChI | InChI=1S/C13H19FO2.BH3O3/c1-12(2,15)13(3,10-14)16-9-11-7-5-4-6-8-11;2-1(3)4/h4-8,15H,9-10H2,1-3H3;2-4H |
| InChIKey | GZWHHWBONPZOPH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|