C6H8F3N3O2S — CID 174908170
N,N-difluorosulfamoyl fluoride;2-prop-2-enyl-1H-imidazole (PubChem CID 174908170) has the molecular formula C6H8F3N3O2S and a molecular weight of 243.21 g/mol. Its IUPAC name is N,N-difluorosulfamoyl fluoride;2-prop-2-enyl-1H-imidazole.
| Compound Name | N,N-difluorosulfamoyl fluoride;2-prop-2-enyl-1H-imidazole |
|---|---|
| PubChem CID | 174908170 |
| Molecular Formula | C6H8F3N3O2S |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | N,N-difluorosulfamoyl fluoride;2-prop-2-enyl-1H-imidazole |
| SMILES | C=CCc1ncc[nH]1.O=S(=O)(F)N(F)F |
| InChI | InChI=1S/C6H8N2.F3NO2S/c1-2-3-6-7-4-5-8-6;1-4(2)7(3,5)6/h2,4-5H,1,3H2,(H,7,8); |
| InChIKey | HNGCVAJXTORLNM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|