C18H16ClNO — CID 174908625
7-[(2-chlorophenyl)methyl]-1,3-dimethylisoquinolin-4-ol (PubChem CID 174908625) has the molecular formula C18H16ClNO and a molecular weight of 297.79 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-1,3-dimethylisoquinolin-4-ol.
| Compound Name | 7-[(2-chlorophenyl)methyl]-1,3-dimethylisoquinolin-4-ol |
|---|---|
| PubChem CID | 174908625 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-1,3-dimethylisoquinolin-4-ol |
| SMILES | Cc1nc(C)c2cc(Cc3ccccc3Cl)ccc2c1O |
| InChI | InChI=1S/C18H16ClNO/c1-11-16-10-13(9-14-5-3-4-6-17(14)19)7-8-15(16)18(21)12(2)20-11/h3-8,10,21H,9H2,1-2H3 |
| InChIKey | FRPHSDBRWGFYEM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |