C11H12N2O2 — CID 174908697
1-(3-methoxyphenyl)-4,5-dihydroimidazole-2-carbaldehyde (PubChem CID 174908697) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4,5-dihydroimidazole-2-carbaldehyde.
| Compound Name | 1-(3-methoxyphenyl)-4,5-dihydroimidazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174908697 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-(3-methoxyphenyl)-4,5-dihydroimidazole-2-carbaldehyde |
| SMILES | COc1cccc(N2CCN=C2C=O)c1 |
| InChI | InChI=1S/C11H12N2O2/c1-15-10-4-2-3-9(7-10)13-6-5-12-11(13)8-14/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | ROSJHXRAXSYBJA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|