About azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate
azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate (PubChem CID 174909619) has the molecular formula C8H15N3O11
and a molecular weight of 329.22 g/mol. Its IUPAC name is azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate.
Molecular Properties
| Compound Name | azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate |
| PubChem CID | 174909619 |
| Molecular Formula | C8H15N3O11 |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate |
| SMILES | N.N.N.O=C(O)O.O=C(O)OC(=O)OC(=O)Oc1ccco1 |
| InChI | InChI=1S/C7H4O8.CH2O3.3H3N/c8-5(9)14-7(11)15-6(10)13-4-2-1-3-12-4;2-1(3)4;;;/h1-3H,(H,8,9);(H2,2,3,4);3*1H3 |
| InChIKey | LGMFGWXPWBDMNS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 274.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate?
The IUPAC name of azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate (CID 174909619) is azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate.
What is the SMILES notation for azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate?
The canonical SMILES for azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate is N.N.N.O=C(O)O.O=C(O)OC(=O)OC(=O)Oc1ccco1.
What is the InChIKey of azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate?
The InChIKey is LGMFGWXPWBDMNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O8.CH2O3.3H3N/c8-5(9)14-7(11)15-6(10)13-4-2-1-3-12-4;2-1(3)4;;;/h1-3H,(H,8,9);(H2,2,3,4);3*1H3.
What are the key properties of azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate?
azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate has a molecular weight of 329.22 g/mol, XLogP of 2.32, 1 rotatable bonds, 6 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carbonic acid;carboxy furan-2-yloxycarbonyl carbonate is sourced from PubChem (CID 174909619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).