About furan-2-yl 3-amino-3-oxopropanoate
furan-2-yl 3-amino-3-oxopropanoate (PubChem CID 141082647) has the molecular formula C7H7NO4
and a molecular weight of 169.14 g/mol. Its IUPAC name is furan-2-yl 3-amino-3-oxopropanoate.
Molecular Properties
| Compound Name | furan-2-yl 3-amino-3-oxopropanoate |
| PubChem CID | 141082647 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | furan-2-yl 3-amino-3-oxopropanoate |
| SMILES | NC(=O)CC(=O)Oc1ccco1 |
| InChI | InChI=1S/C7H7NO4/c8-5(9)4-6(10)12-7-2-1-3-11-7/h1-3H,4H2,(H2,8,9) |
| InChIKey | XMVRASCTLITXLG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze furan-2-yl 3-amino-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-yl 3-amino-3-oxopropanoate?
The IUPAC name of furan-2-yl 3-amino-3-oxopropanoate (CID 141082647) is furan-2-yl 3-amino-3-oxopropanoate.
What is the SMILES notation for furan-2-yl 3-amino-3-oxopropanoate?
The canonical SMILES for furan-2-yl 3-amino-3-oxopropanoate is NC(=O)CC(=O)Oc1ccco1.
What is the InChIKey of furan-2-yl 3-amino-3-oxopropanoate?
The InChIKey is XMVRASCTLITXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c8-5(9)4-6(10)12-7-2-1-3-11-7/h1-3H,4H2,(H2,8,9).
What are the key properties of furan-2-yl 3-amino-3-oxopropanoate?
furan-2-yl 3-amino-3-oxopropanoate has a molecular weight of 169.14 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-yl 3-amino-3-oxopropanoate is sourced from PubChem (CID 141082647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).