About furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate
furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 90119639) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| PubChem CID | 90119639 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)Oc1ccco1 |
| InChI | InChI=1S/C13H13NO4/c14-11(8-9-3-5-10(15)6-4-9)13(16)18-12-2-1-7-17-12/h1-7,11,15H,8,14H2/t11-/m0/s1 |
| InChIKey | SGPXKNRTAOMFNA-NSHDSACASA-N |
| XLogP | 1.46 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The IUPAC name of furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (CID 90119639) is furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
What is the SMILES notation for furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The canonical SMILES for furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate is N[C@@H](Cc1ccc(O)cc1)C(=O)Oc1ccco1.
What is the InChIKey of furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The InChIKey is SGPXKNRTAOMFNA-NSHDSACASA-N. The full InChI is InChI=1S/C13H13NO4/c14-11(8-9-3-5-10(15)6-4-9)13(16)18-12-2-1-7-17-12/h1-7,11,15H,8,14H2/t11-/m0/s1.
What are the key properties of furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate has a molecular weight of 247.25 g/mol, XLogP of 1.46, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate is sourced from PubChem (CID 90119639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).