About [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate
[deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 87058877) has the molecular formula C10H12FNO3
and a molecular weight of 214.21 g/mol. Its IUPAC name is [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| PubChem CID | 87058877 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | [2H]C(F)OC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12FNO3/c11-6-15-10(14)9(12)5-7-1-3-8(13)4-2-7/h1-4,9,13H,5-6,12H2/t9-/m0/s1/i6D/t6?,9- |
| InChIKey | SGRBYFWBTCFLBB-JVZLQTKXSA-N |
| XLogP | 0.73 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The IUPAC name of [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (CID 87058877) is [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
What is the SMILES notation for [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The canonical SMILES for [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate is [2H]C(F)OC(=O)[C@@H](N)Cc1ccc(O)cc1.
What is the InChIKey of [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The InChIKey is SGRBYFWBTCFLBB-JVZLQTKXSA-N. The full InChI is InChI=1S/C10H12FNO3/c11-6-15-10(14)9(12)5-7-1-3-8(13)4-2-7/h1-4,9,13H,5-6,12H2/t9-/m0/s1/i6D/t6?,9-.
What are the key properties of [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
[deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate has a molecular weight of 214.21 g/mol, XLogP of 0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [deuterio(fluoro)methyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate is sourced from PubChem (CID 87058877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).