C17H13FN2O3S — CID 17491245
N-[5-[(4-fluorophenyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide (PubChem CID 17491245) has the molecular formula C17H13FN2O3S and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[5-[(4-fluorophenyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(4-fluorophenyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17491245 |
| Molecular Formula | C17H13FN2O3S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[5-[(4-fluorophenyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN2O3S/c1-10-9-14(20-16(21)13-3-2-8-23-13)24-15(10)17(22)19-12-6-4-11(18)5-7-12/h2-9H,1H3,(H,19,22)(H,20,21) |
| InChIKey | OMDLBKFZPOIHGD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |