C19H15N3O3S — CID 35708139
N-[5-[[4-(cyanomethyl)phenyl]carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide (PubChem CID 35708139) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[5-[[4-(cyanomethyl)phenyl]carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[[4-(cyanomethyl)phenyl]carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 35708139 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[5-[[4-(cyanomethyl)phenyl]carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C19H15N3O3S/c1-12-11-16(22-18(23)15-3-2-10-25-15)26-17(12)19(24)21-14-6-4-13(5-7-14)8-9-20/h2-7,10-11H,8H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | DIGMQIVHBPFXMO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |