C12H10Cl2N4O2 — CID 174912751
4-N-chloro-4-N-(4-chloro-2-nitrophenyl)benzene-1,2,4-triamine (PubChem CID 174912751) has the molecular formula C12H10Cl2N4O2 and a molecular weight of 313.14 g/mol. Its IUPAC name is 4-N-chloro-4-N-(4-chloro-2-nitrophenyl)benzene-1,2,4-triamine.
| Compound Name | 4-N-chloro-4-N-(4-chloro-2-nitrophenyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 174912751 |
| Molecular Formula | C12H10Cl2N4O2 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 4-N-chloro-4-N-(4-chloro-2-nitrophenyl)benzene-1,2,4-triamine |
| SMILES | Nc1ccc(N(Cl)c2ccc(Cl)cc2[N+](=O)[O-])cc1N |
| InChI | InChI=1S/C12H10Cl2N4O2/c13-7-1-4-11(12(5-7)18(19)20)17(14)8-2-3-9(15)10(16)6-8/h1-6H,15-16H2 |
| InChIKey | BHZCMWSMOCWPIL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|