About dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+)
dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+) (PubChem CID 174913955) has the molecular formula C3H3BMnN2O3
and a molecular weight of 180.82 g/mol. Its IUPAC name is dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+).
Molecular Properties
| Compound Name | dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+) |
| PubChem CID | 174913955 |
| Molecular Formula | C3H3BMnN2O3 |
| Molecular Weight | 180.82 g/mol |
| Exact Mass | 180.96 |
| IUPAC Name | dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+) |
| SMILES | [Mn+2].[O-]B([O-])Oc1ccn[nH]1 |
| InChI | InChI=1S/C3H3BN2O3.Mn/c7-4(8)9-3-1-2-5-6-3;/h1-2H,(H,5,6);/q-2;+2 |
| InChIKey | MIABZNZHXRERTQ-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.82 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+)?
The IUPAC name of dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+) (CID 174913955) is dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+).
What is the SMILES notation for dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+)?
The canonical SMILES for dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+) is [Mn+2].[O-]B([O-])Oc1ccn[nH]1.
What is the InChIKey of dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+)?
The InChIKey is MIABZNZHXRERTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3BN2O3.Mn/c7-4(8)9-3-1-2-5-6-3;/h1-2H,(H,5,6);/q-2;+2.
What are the key properties of dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+)?
dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+) has a molecular weight of 180.82 g/mol, XLogP of -2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(1H-pyrazol-5-yloxy)borane;manganese(2+) is sourced from PubChem (CID 174913955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).