About sodium;methanesulfonate;5-methoxy-1H-pyrazole
sodium;methanesulfonate;5-methoxy-1H-pyrazole (PubChem CID 175600051) has the molecular formula C5H9N2NaO4S
and a molecular weight of 216.19 g/mol. Its IUPAC name is sodium;methanesulfonate;5-methoxy-1H-pyrazole.
Molecular Properties
| Compound Name | sodium;methanesulfonate;5-methoxy-1H-pyrazole |
| PubChem CID | 175600051 |
| Molecular Formula | C5H9N2NaO4S |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | sodium;methanesulfonate;5-methoxy-1H-pyrazole |
| SMILES | COc1ccn[nH]1.CS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H6N2O.CH4O3S.Na/c1-7-4-2-3-5-6-4;1-5(2,3)4;/h2-3H,1H3,(H,5,6);1H3,(H,2,3,4);/q;;+1/p-1 |
| InChIKey | UWENCRWGYNLDSH-UHFFFAOYSA-M |
| XLogP | -3.42 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;methanesulfonate;5-methoxy-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;methanesulfonate;5-methoxy-1H-pyrazole?
The IUPAC name of sodium;methanesulfonate;5-methoxy-1H-pyrazole (CID 175600051) is sodium;methanesulfonate;5-methoxy-1H-pyrazole.
What is the SMILES notation for sodium;methanesulfonate;5-methoxy-1H-pyrazole?
The canonical SMILES for sodium;methanesulfonate;5-methoxy-1H-pyrazole is COc1ccn[nH]1.CS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium;methanesulfonate;5-methoxy-1H-pyrazole?
The InChIKey is UWENCRWGYNLDSH-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6N2O.CH4O3S.Na/c1-7-4-2-3-5-6-4;1-5(2,3)4;/h2-3H,1H3,(H,5,6);1H3,(H,2,3,4);/q;;+1/p-1.
What are the key properties of sodium;methanesulfonate;5-methoxy-1H-pyrazole?
sodium;methanesulfonate;5-methoxy-1H-pyrazole has a molecular weight of 216.19 g/mol, XLogP of -3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;methanesulfonate;5-methoxy-1H-pyrazole is sourced from PubChem (CID 175600051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).