About 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride
5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride (PubChem CID 175600069) has the molecular formula C5H8Cl2F2N2O3S
and a molecular weight of 285.10 g/mol. Its IUPAC name is 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride.
Molecular Properties
| Compound Name | 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride |
| PubChem CID | 175600069 |
| Molecular Formula | C5H8Cl2F2N2O3S |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride |
| SMILES | C.FC(F)Oc1ccn[nH]1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C4H4F2N2O.CH4.Cl2O2S/c5-4(6)9-3-1-2-7-8-3;;1-5(2,3)4/h1-2,4H,(H,7,8);1H4; |
| InChIKey | NKGVXOOCUGLXGL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride?
The IUPAC name of 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride (CID 175600069) is 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride.
What is the SMILES notation for 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride?
The canonical SMILES for 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride is C.FC(F)Oc1ccn[nH]1.O=S(=O)(Cl)Cl.
What is the InChIKey of 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride?
The InChIKey is NKGVXOOCUGLXGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F2N2O.CH4.Cl2O2S/c5-4(6)9-3-1-2-7-8-3;;1-5(2,3)4/h1-2,4H,(H,7,8);1H4;.
What are the key properties of 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride?
5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride has a molecular weight of 285.10 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethoxy)-1H-pyrazole;methane;sulfuryl dichloride is sourced from PubChem (CID 175600069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).