About pyrrole-3,3-diamine
pyrrole-3,3-diamine (PubChem CID 174916290) has the molecular formula C4H7N3
and a molecular weight of 97.12 g/mol. Its IUPAC name is pyrrole-3,3-diamine.
Molecular Properties
| Compound Name | pyrrole-3,3-diamine |
| PubChem CID | 174916290 |
| Molecular Formula | C4H7N3 |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.06 |
| IUPAC Name | pyrrole-3,3-diamine |
| SMILES | NC1(N)C=CN=C1 |
| InChI | InChI=1S/C4H7N3/c5-4(6)1-2-7-3-4/h1-3H,5-6H2 |
| InChIKey | WBUJMNCLRRAMCU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze pyrrole-3,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-3,3-diamine?
The IUPAC name of pyrrole-3,3-diamine (CID 174916290) is pyrrole-3,3-diamine.
What is the SMILES notation for pyrrole-3,3-diamine?
The canonical SMILES for pyrrole-3,3-diamine is NC1(N)C=CN=C1.
What is the InChIKey of pyrrole-3,3-diamine?
The InChIKey is WBUJMNCLRRAMCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3/c5-4(6)1-2-7-3-4/h1-3H,5-6H2.
What are the key properties of pyrrole-3,3-diamine?
pyrrole-3,3-diamine has a molecular weight of 97.12 g/mol, XLogP of -0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-3,3-diamine is sourced from PubChem (CID 174916290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).