C19H19FN2O3 — CID 174918870
[3-[benzoyl(1-cyclopropylethyl)amino]-2-fluorophenyl] carbamate (PubChem CID 174918870) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is [3-[benzoyl(1-cyclopropylethyl)amino]-2-fluorophenyl] carbamate.
| Compound Name | [3-[benzoyl(1-cyclopropylethyl)amino]-2-fluorophenyl] carbamate |
|---|---|
| PubChem CID | 174918870 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [3-[benzoyl(1-cyclopropylethyl)amino]-2-fluorophenyl] carbamate |
| SMILES | CC(C1CC1)N(C(=O)c1ccccc1)c1cccc(OC(N)=O)c1F |
| InChI | InChI=1S/C19H19FN2O3/c1-12(13-10-11-13)22(18(23)14-6-3-2-4-7-14)15-8-5-9-16(17(15)20)25-19(21)24/h2-9,12-13H,10-11H2,1H3,(H2,21,24) |
| InChIKey | SHGLUYMYKFXQBA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |