C40H46N4O4 — CID 160984605
N'-benzoyl-N'-(1-cyclopropylethyl)benzohydrazide;N'-benzoyl-N'-(2,4-dimethylpentan-3-yl)benzohydrazide (PubChem CID 160984605) has the molecular formula C40H46N4O4 and a molecular weight of 646.83 g/mol. Its IUPAC name is N'-benzoyl-N'-(1-cyclopropylethyl)benzohydrazide;N'-benzoyl-N'-(2,4-dimethylpentan-3-yl)benzohydrazide.
| Compound Name | N'-benzoyl-N'-(1-cyclopropylethyl)benzohydrazide;N'-benzoyl-N'-(2,4-dimethylpentan-3-yl)benzohydrazide |
|---|---|
| PubChem CID | 160984605 |
| Molecular Formula | C40H46N4O4 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | N'-benzoyl-N'-(1-cyclopropylethyl)benzohydrazide;N'-benzoyl-N'-(2,4-dimethylpentan-3-yl)benzohydrazide |
| SMILES | CC(C)C(C(C)C)N(NC(=O)c1ccccc1)C(=O)c1ccccc1.CC(C1CC1)N(NC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2.C19H20N2O2/c1-15(2)19(16(3)4)23(21(25)18-13-9-6-10-14-18)22-20(24)17-11-7-5-8-12-17;1-14(15-12-13-15)21(19(23)17-10-6-3-7-11-17)20-18(22)16-8-4-2-5-9-16/h5-16,19H,1-4H3,(H,22,24);2-11,14-15H,12-13H2,1H3,(H,20,22) |
| InChIKey | SZYPIFNSCDQUIM-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|