About N-cyclohexylmorpholin-4-amine;phosphoric acid
N-cyclohexylmorpholin-4-amine;phosphoric acid (PubChem CID 174919076) has the molecular formula C10H23N2O5P
and a molecular weight of 282.28 g/mol. Its IUPAC name is N-cyclohexylmorpholin-4-amine;phosphoric acid.
Molecular Properties
| Compound Name | N-cyclohexylmorpholin-4-amine;phosphoric acid |
| PubChem CID | 174919076 |
| Molecular Formula | C10H23N2O5P |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | N-cyclohexylmorpholin-4-amine;phosphoric acid |
| SMILES | C1CCC(NN2CCOCC2)CC1.O=P(O)(O)O |
| InChI | InChI=1S/C10H20N2O.H3O4P/c1-2-4-10(5-3-1)11-12-6-8-13-9-7-12;1-5(2,3)4/h10-11H,1-9H2;(H3,1,2,3,4) |
| InChIKey | IAQOXSDBVOXRGL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylmorpholin-4-amine;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylmorpholin-4-amine;phosphoric acid?
The IUPAC name of N-cyclohexylmorpholin-4-amine;phosphoric acid (CID 174919076) is N-cyclohexylmorpholin-4-amine;phosphoric acid.
What is the SMILES notation for N-cyclohexylmorpholin-4-amine;phosphoric acid?
The canonical SMILES for N-cyclohexylmorpholin-4-amine;phosphoric acid is C1CCC(NN2CCOCC2)CC1.O=P(O)(O)O.
What is the InChIKey of N-cyclohexylmorpholin-4-amine;phosphoric acid?
The InChIKey is IAQOXSDBVOXRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.H3O4P/c1-2-4-10(5-3-1)11-12-6-8-13-9-7-12;1-5(2,3)4/h10-11H,1-9H2;(H3,1,2,3,4).
What are the key properties of N-cyclohexylmorpholin-4-amine;phosphoric acid?
N-cyclohexylmorpholin-4-amine;phosphoric acid has a molecular weight of 282.28 g/mol, XLogP of 0.23, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylmorpholin-4-amine;phosphoric acid is sourced from PubChem (CID 174919076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).