N-cyclohexylmorpholin-4-amine;phosphoric acid

C10H23N2O5P — CID 174919076

IUPACN-cyclohexylmorpholin-4-amine;phosphoric acid
SMILESC1CCC(NN2CCOCC2)CC1.O=P(O)(O)O
InChIInChI=1S/C10H20N2O.H3O4P/c1-2-4-10(5-3-1)11-12-6-8-13-9-7-12;1-5(2,3)4/h10-11H,1-9H2;(H3,1,2,3,4)
InChIKeyIAQOXSDBVOXRGL-UHFFFAOYSA-N
MW282.28 g/mol
LogP0.23
Rot. Bonds2

About N-cyclohexylmorpholin-4-amine;phosphoric acid

N-cyclohexylmorpholin-4-amine;phosphoric acid (PubChem CID 174919076) has the molecular formula C10H23N2O5P and a molecular weight of 282.28 g/mol. Its IUPAC name is N-cyclohexylmorpholin-4-amine;phosphoric acid.

Molecular Properties

Compound NameN-cyclohexylmorpholin-4-amine;phosphoric acid
PubChem CID174919076
Molecular FormulaC10H23N2O5P
Molecular Weight282.28 g/mol
Exact Mass282.13
IUPAC NameN-cyclohexylmorpholin-4-amine;phosphoric acid
SMILESC1CCC(NN2CCOCC2)CC1.O=P(O)(O)O
InChIInChI=1S/C10H20N2O.H3O4P/c1-2-4-10(5-3-1)11-12-6-8-13-9-7-12;1-5(2,3)4/h10-11H,1-9H2;(H3,1,2,3,4)
InChIKeyIAQOXSDBVOXRGL-UHFFFAOYSA-N
XLogP0.23
TPSA102.26 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.28
LogP ≤ 50.23
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze N-cyclohexylmorpholin-4-amine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-cyclohexylmorpholin-4-amine;phosphoric acid?
The IUPAC name of N-cyclohexylmorpholin-4-amine;phosphoric acid (CID 174919076) is N-cyclohexylmorpholin-4-amine;phosphoric acid.
What is the SMILES notation for N-cyclohexylmorpholin-4-amine;phosphoric acid?
The canonical SMILES for N-cyclohexylmorpholin-4-amine;phosphoric acid is C1CCC(NN2CCOCC2)CC1.O=P(O)(O)O.
What is the InChIKey of N-cyclohexylmorpholin-4-amine;phosphoric acid?
The InChIKey is IAQOXSDBVOXRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.H3O4P/c1-2-4-10(5-3-1)11-12-6-8-13-9-7-12;1-5(2,3)4/h10-11H,1-9H2;(H3,1,2,3,4).
What are the key properties of N-cyclohexylmorpholin-4-amine;phosphoric acid?
N-cyclohexylmorpholin-4-amine;phosphoric acid has a molecular weight of 282.28 g/mol, XLogP of 0.23, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylmorpholin-4-amine;phosphoric acid is sourced from PubChem (CID 174919076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).