C18H22BrN3OS — CID 17491998
N-(4-bromo-3-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]acetamide (PubChem CID 17491998) has the molecular formula C18H22BrN3OS and a molecular weight of 408.37 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17491998 |
| Molecular Formula | C18H22BrN3OS |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]acetamide |
| SMILES | Cc1cc(NC(=O)CN2CCN(Cc3ccsc3)CC2)ccc1Br |
| InChI | InChI=1S/C18H22BrN3OS/c1-14-10-16(2-3-17(14)19)20-18(23)12-22-7-5-21(6-8-22)11-15-4-9-24-13-15/h2-4,9-10,13H,5-8,11-12H2,1H3,(H,20,23) |
| InChIKey | WFWHPDZVYZSIJW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |