C17H20ClN3OS — CID 17491999
N-(3-chlorophenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]acetamide (PubChem CID 17491999) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17491999 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(3-chlorophenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccsc2)CC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3OS/c18-15-2-1-3-16(10-15)19-17(22)12-21-7-5-20(6-8-21)11-14-4-9-23-13-14/h1-4,9-10,13H,5-8,11-12H2,(H,19,22) |
| InChIKey | CDZDTOMVCRQXSJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |