C6H9F6N2O2P — CID 174920085
hydron;2-(1-methylimidazol-2-yl)acetic acid;hexafluorophosphate (PubChem CID 174920085) has the molecular formula C6H9F6N2O2P and a molecular weight of 286.11 g/mol. Its IUPAC name is hydron;2-(1-methylimidazol-2-yl)acetic acid;hexafluorophosphate.
| Compound Name | hydron;2-(1-methylimidazol-2-yl)acetic acid;hexafluorophosphate |
|---|---|
| PubChem CID | 174920085 |
| Molecular Formula | C6H9F6N2O2P |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | hydron;2-(1-methylimidazol-2-yl)acetic acid;hexafluorophosphate |
| SMILES | Cn1ccnc1CC(=O)O.F[P-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C6H8N2O2.F6P/c1-8-3-2-7-5(8)4-6(9)10;1-7(2,3,4,5)6/h2-3H,4H2,1H3,(H,9,10);/q;-1/p+1 |
| InChIKey | JODIPHZZZBSXMB-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|