3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid

C10H16N2O2 — CID 81003658

IUPAC3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid
SMILESCn1ccnc1CC(C)(C)CC(=O)O
InChIInChI=1S/C10H16N2O2/c1-10(2,7-9(13)14)6-8-11-4-5-12(8)3/h4-5H,6-7H2,1-3H3,(H,13,14)
InChIKeyFQJVLNCWKHQQFL-UHFFFAOYSA-N
MW196.25 g/mol
LogP1.46
Rot. Bonds4

About 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid

3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid (PubChem CID 81003658) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid.

Molecular Properties

Compound Name3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid
PubChem CID81003658
Molecular FormulaC10H16N2O2
Molecular Weight196.25 g/mol
Exact Mass196.12
IUPAC Name3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid
SMILESCn1ccnc1CC(C)(C)CC(=O)O
InChIInChI=1S/C10H16N2O2/c1-10(2,7-9(13)14)6-8-11-4-5-12(8)3/h4-5H,6-7H2,1-3H3,(H,13,14)
InChIKeyFQJVLNCWKHQQFL-UHFFFAOYSA-N
XLogP1.46
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.25
LogP ≤ 51.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid?
The IUPAC name of 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid (CID 81003658) is 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid.
What is the SMILES notation for 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid?
The canonical SMILES for 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid is Cn1ccnc1CC(C)(C)CC(=O)O.
What is the InChIKey of 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid?
The InChIKey is FQJVLNCWKHQQFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-10(2,7-9(13)14)6-8-11-4-5-12(8)3/h4-5H,6-7H2,1-3H3,(H,13,14).
What are the key properties of 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid?
3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid has a molecular weight of 196.25 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-4-(1-methylimidazol-2-yl)butanoic acid is sourced from PubChem (CID 81003658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).