C29H30N4O — CID 174920568
1,1,5,5-tetrakis(4-aminophenyl)pentan-3-one (PubChem CID 174920568) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is 1,1,5,5-tetrakis(4-aminophenyl)pentan-3-one.
| Compound Name | 1,1,5,5-tetrakis(4-aminophenyl)pentan-3-one |
|---|---|
| PubChem CID | 174920568 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1,1,5,5-tetrakis(4-aminophenyl)pentan-3-one |
| SMILES | Nc1ccc(C(CC(=O)CC(c2ccc(N)cc2)c2ccc(N)cc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C29H30N4O/c30-23-9-1-19(2-10-23)28(20-3-11-24(31)12-4-20)17-27(34)18-29(21-5-13-25(32)14-6-21)22-7-15-26(33)16-8-22/h1-16,28-29H,17-18,30-33H2 |
| InChIKey | WQZJAJGERITWNW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|