C17H14F6N2O — CID 151270804
2,4-bis(4-aminophenyl)-1,1,1,5,5,5-hexafluoropentan-3-one (PubChem CID 151270804) has the molecular formula C17H14F6N2O and a molecular weight of 376.30 g/mol. Its IUPAC name is 2,4-bis(4-aminophenyl)-1,1,1,5,5,5-hexafluoropentan-3-one.
| Compound Name | 2,4-bis(4-aminophenyl)-1,1,1,5,5,5-hexafluoropentan-3-one |
|---|---|
| PubChem CID | 151270804 |
| Molecular Formula | C17H14F6N2O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2,4-bis(4-aminophenyl)-1,1,1,5,5,5-hexafluoropentan-3-one |
| SMILES | Nc1ccc(C(C(=O)C(c2ccc(N)cc2)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F6N2O/c18-16(19,20)13(9-1-5-11(24)6-2-9)15(26)14(17(21,22)23)10-3-7-12(25)8-4-10/h1-8,13-14H,24-25H2 |
| InChIKey | NWHYIXWQFOURIX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|