C13H10F6N2O — CID 140967876
1,1,1,5,5,5-hexafluoro-2,4-bis(1H-pyrrol-3-yl)pentan-3-one (PubChem CID 140967876) has the molecular formula C13H10F6N2O and a molecular weight of 324.22 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-2,4-bis(1H-pyrrol-3-yl)pentan-3-one.
| Compound Name | 1,1,1,5,5,5-hexafluoro-2,4-bis(1H-pyrrol-3-yl)pentan-3-one |
|---|---|
| PubChem CID | 140967876 |
| Molecular Formula | C13H10F6N2O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-2,4-bis(1H-pyrrol-3-yl)pentan-3-one |
| SMILES | O=C(C(c1cc[nH]c1)C(F)(F)F)C(c1cc[nH]c1)C(F)(F)F |
| InChI | InChI=1S/C13H10F6N2O/c14-12(15,16)9(7-1-3-20-5-7)11(22)10(13(17,18)19)8-2-4-21-6-8/h1-6,9-10,20-21H |
| InChIKey | NJIWRYBFIVOQLU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |