C7H7Cl2F2N — CID 150047183
3-(1,3-dichloro-3,3-difluoropropyl)-1H-pyrrole (PubChem CID 150047183) has the molecular formula C7H7Cl2F2N and a molecular weight of 214.04 g/mol. Its IUPAC name is 3-(1,3-dichloro-3,3-difluoropropyl)-1H-pyrrole.
| Compound Name | 3-(1,3-dichloro-3,3-difluoropropyl)-1H-pyrrole |
|---|---|
| PubChem CID | 150047183 |
| Molecular Formula | C7H7Cl2F2N |
| Molecular Weight | 214.04 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | 3-(1,3-dichloro-3,3-difluoropropyl)-1H-pyrrole |
| SMILES | FC(F)(Cl)CC(Cl)c1cc[nH]c1 |
| InChI | InChI=1S/C7H7Cl2F2N/c8-6(3-7(9,10)11)5-1-2-12-4-5/h1-2,4,6,12H,3H2 |
| InChIKey | DKNHWIAGWXGNLQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.04 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|