C11H12F2NO2- — CID 154438667
2-(4-aminophenyl)-5,5-difluoropentanoate (PubChem CID 154438667) has the molecular formula C11H12F2NO2- and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5,5-difluoropentanoate.
| Compound Name | 2-(4-aminophenyl)-5,5-difluoropentanoate |
|---|---|
| PubChem CID | 154438667 |
| Molecular Formula | C11H12F2NO2- |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-(4-aminophenyl)-5,5-difluoropentanoate |
| SMILES | Nc1ccc(C(CCC(F)F)C(=O)[O-])cc1 |
| InChI | InChI=1S/C11H13F2NO2/c12-10(13)6-5-9(11(15)16)7-1-3-8(14)4-2-7/h1-4,9-10H,5-6,14H2,(H,15,16)/p-1 |
| InChIKey | ZNNIJJHYFHWXBY-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|