About 2-(4-aminophenyl)-5,5-difluoropentanoate
2-(4-aminophenyl)-5,5-difluoropentanoate (PubChem CID 154438667) has the molecular formula C11H12F2NO2-
and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5,5-difluoropentanoate.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)-5,5-difluoropentanoate |
| PubChem CID | 154438667 |
| Molecular Formula | C11H12F2NO2- |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-(4-aminophenyl)-5,5-difluoropentanoate |
| SMILES | Nc1ccc(C(CCC(F)F)C(=O)[O-])cc1 |
| InChI | InChI=1S/C11H13F2NO2/c12-10(13)6-5-9(11(15)16)7-1-3-8(14)4-2-7/h1-4,9-10H,5-6,14H2,(H,15,16)/p-1 |
| InChIKey | ZNNIJJHYFHWXBY-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)-5,5-difluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)-5,5-difluoropentanoate?
The IUPAC name of 2-(4-aminophenyl)-5,5-difluoropentanoate (CID 154438667) is 2-(4-aminophenyl)-5,5-difluoropentanoate.
What is the SMILES notation for 2-(4-aminophenyl)-5,5-difluoropentanoate?
The canonical SMILES for 2-(4-aminophenyl)-5,5-difluoropentanoate is Nc1ccc(C(CCC(F)F)C(=O)[O-])cc1.
What is the InChIKey of 2-(4-aminophenyl)-5,5-difluoropentanoate?
The InChIKey is ZNNIJJHYFHWXBY-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13F2NO2/c12-10(13)6-5-9(11(15)16)7-1-3-8(14)4-2-7/h1-4,9-10H,5-6,14H2,(H,15,16)/p-1.
What are the key properties of 2-(4-aminophenyl)-5,5-difluoropentanoate?
2-(4-aminophenyl)-5,5-difluoropentanoate has a molecular weight of 228.22 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)-5,5-difluoropentanoate is sourced from PubChem (CID 154438667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).