C26H30F4N2O6 — CID 159062943
ethyl 2-(4-aminophenyl)-5,5-difluoropentanoate;ethyl 5,5-difluoro-2-(4-nitrophenyl)pent-4-enoate (PubChem CID 159062943) has the molecular formula C26H30F4N2O6 and a molecular weight of 542.53 g/mol. Its IUPAC name is ethyl 2-(4-aminophenyl)-5,5-difluoropentanoate;ethyl 5,5-difluoro-2-(4-nitrophenyl)pent-4-enoate.
| Compound Name | ethyl 2-(4-aminophenyl)-5,5-difluoropentanoate;ethyl 5,5-difluoro-2-(4-nitrophenyl)pent-4-enoate |
|---|---|
| PubChem CID | 159062943 |
| Molecular Formula | C26H30F4N2O6 |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | ethyl 2-(4-aminophenyl)-5,5-difluoropentanoate;ethyl 5,5-difluoro-2-(4-nitrophenyl)pent-4-enoate |
| SMILES | CCOC(=O)C(CC=C(F)F)c1ccc([N+](=O)[O-])cc1.CCOC(=O)C(CCC(F)F)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H13F2NO4.C13H17F2NO2/c1-2-20-13(17)11(7-8-12(14)15)9-3-5-10(6-4-9)16(18)19;1-2-18-13(17)11(7-8-12(14)15)9-3-5-10(16)6-4-9/h3-6,8,11H,2,7H2,1H3;3-6,11-12H,2,7-8,16H2,1H3 |
| InChIKey | JYRWOJIKBFCHLE-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|