About (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone
(4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone (PubChem CID 174921124) has the molecular formula C19H20N2O
and a molecular weight of 292.38 g/mol. Its IUPAC name is (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone.
Molecular Properties
| Compound Name | (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone |
| PubChem CID | 174921124 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone |
| SMILES | O=C([C@H]1CCNC1)N1CCc2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C19H20N2O/c22-19(15-9-11-20-13-15)21-12-10-17-16(7-4-8-18(17)21)14-5-2-1-3-6-14/h1-8,15,20H,9-13H2/t15-/m0/s1 |
| InChIKey | ZBGVFKUCHFFDQE-HNNXBMFYSA-N |
| XLogP | 2.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone?
The IUPAC name of (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone (CID 174921124) is (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone.
What is the SMILES notation for (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone?
The canonical SMILES for (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone is O=C([C@H]1CCNC1)N1CCc2c(-c3ccccc3)cccc21.
What is the InChIKey of (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone?
The InChIKey is ZBGVFKUCHFFDQE-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H20N2O/c22-19(15-9-11-20-13-15)21-12-10-17-16(7-4-8-18(17)21)14-5-2-1-3-6-14/h1-8,15,20H,9-13H2/t15-/m0/s1.
What are the key properties of (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone?
(4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone has a molecular weight of 292.38 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenyl-2,3-dihydroindol-1-yl)-[(3S)-pyrrolidin-3-yl]methanone is sourced from PubChem (CID 174921124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).