About (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride
(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride (PubChem CID 119891426) has the molecular formula C21H27Cl2N3O
and a molecular weight of 408.37 g/mol. Its IUPAC name is (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride.
Molecular Properties
| Compound Name | (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride |
| PubChem CID | 119891426 |
| Molecular Formula | C21H27Cl2N3O |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CCNC1)N1CCCN(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H25N3O.2ClH/c25-21(18-11-12-22-15-18)24-14-6-13-23(16-17-7-2-1-3-8-17)19-9-4-5-10-20(19)24;;/h1-5,7-10,18,22H,6,11-16H2;2*1H |
| InChIKey | BOQYGWNAGSRBNF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride?
The IUPAC name of (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride (CID 119891426) is (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride.
What is the SMILES notation for (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride?
The canonical SMILES for (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride is Cl.Cl.O=C(C1CCNC1)N1CCCN(Cc2ccccc2)c2ccccc21.
What is the InChIKey of (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride?
The InChIKey is BOQYGWNAGSRBNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O.2ClH/c25-21(18-11-12-22-15-18)24-14-6-13-23(16-17-7-2-1-3-8-17)19-9-4-5-10-20(19)24;;/h1-5,7-10,18,22H,6,11-16H2;2*1H.
What are the key properties of (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride?
(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride has a molecular weight of 408.37 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)-pyrrolidin-3-ylmethanone;dihydrochloride is sourced from PubChem (CID 119891426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).