About 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one
2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one (PubChem CID 119891407) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one |
| PubChem CID | 119891407 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one |
| SMILES | CC(N)C(=O)N1CCCN(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H23N3O/c1-15(20)19(23)22-13-7-12-21(14-16-8-3-2-4-9-16)17-10-5-6-11-18(17)22/h2-6,8-11,15H,7,12-14,20H2,1H3 |
| InChIKey | JFXIETQACXDRRM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one?
The IUPAC name of 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one (CID 119891407) is 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one.
What is the SMILES notation for 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one?
The canonical SMILES for 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one is CC(N)C(=O)N1CCCN(Cc2ccccc2)c2ccccc21.
What is the InChIKey of 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one?
The InChIKey is JFXIETQACXDRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O/c1-15(20)19(23)22-13-7-12-21(14-16-8-3-2-4-9-16)17-10-5-6-11-18(17)22/h2-6,8-11,15H,7,12-14,20H2,1H3.
What are the key properties of 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one?
2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one has a molecular weight of 309.41 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(1-benzyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl)propan-1-one is sourced from PubChem (CID 119891407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).