C13H19N3O — CID 83631875
2-amino-1-(4-ethyl-2,3-dihydroquinoxalin-1-yl)propan-1-one (PubChem CID 83631875) has the molecular formula C13H19N3O and a molecular weight of 233.32 g/mol. Its IUPAC name is 2-amino-1-(4-ethyl-2,3-dihydroquinoxalin-1-yl)propan-1-one.
| Compound Name | 2-amino-1-(4-ethyl-2,3-dihydroquinoxalin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 83631875 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-amino-1-(4-ethyl-2,3-dihydroquinoxalin-1-yl)propan-1-one |
| SMILES | CCN1CCN(C(=O)C(C)N)c2ccccc21 |
| InChI | InChI=1S/C13H19N3O/c1-3-15-8-9-16(13(17)10(2)14)12-7-5-4-6-11(12)15/h4-7,10H,3,8-9,14H2,1-2H3 |
| InChIKey | RBUMEXAEMHWUKF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |