About [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea
[3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea (PubChem CID 75443696) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea.
Molecular Properties
| Compound Name | [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea |
| PubChem CID | 75443696 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea |
| SMILES | NC(=O)NCCC(=O)N1CCN(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H22N4O2/c20-19(25)21-11-10-18(24)23-13-12-22(14-15-6-2-1-3-7-15)16-8-4-5-9-17(16)23/h1-9H,10-14H2,(H3,20,21,25) |
| InChIKey | BZMYZNFECXFCHB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea?
The IUPAC name of [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea (CID 75443696) is [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea.
What is the SMILES notation for [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea?
The canonical SMILES for [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea is NC(=O)NCCC(=O)N1CCN(Cc2ccccc2)c2ccccc21.
What is the InChIKey of [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea?
The InChIKey is BZMYZNFECXFCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c20-19(25)21-11-10-18(24)23-13-12-22(14-15-6-2-1-3-7-15)16-8-4-5-9-17(16)23/h1-9H,10-14H2,(H3,20,21,25).
What are the key properties of [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea?
[3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea has a molecular weight of 338.41 g/mol, XLogP of 2.10, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-benzyl-2,3-dihydroquinoxalin-1-yl)-3-oxopropyl]urea is sourced from PubChem (CID 75443696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).