C22H22N4O — CID 10618387
(4-aminophenyl)-[1-(pyridin-3-ylmethyl)-3,4-dihydro-2H-1,5-benzodiazepin-5-yl]methanone (PubChem CID 10618387) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is (4-aminophenyl)-[1-(pyridin-3-ylmethyl)-3,4-dihydro-2H-1,5-benzodiazepin-5-yl]methanone.
| Compound Name | (4-aminophenyl)-[1-(pyridin-3-ylmethyl)-3,4-dihydro-2H-1,5-benzodiazepin-5-yl]methanone |
|---|---|
| PubChem CID | 10618387 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (4-aminophenyl)-[1-(pyridin-3-ylmethyl)-3,4-dihydro-2H-1,5-benzodiazepin-5-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2CCCN(Cc3cccnc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H22N4O/c23-19-10-8-18(9-11-19)22(27)26-14-4-13-25(16-17-5-3-12-24-15-17)20-6-1-2-7-21(20)26/h1-3,5-12,15H,4,13-14,16,23H2 |
| InChIKey | KZDKHRLCNOTHQJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|