C22H27N3O2 — CID 42484485
1-(4-tert-butylbenzoyl)-4-(pyridin-3-ylmethyl)-1,4-diazepan-5-one (PubChem CID 42484485) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(4-tert-butylbenzoyl)-4-(pyridin-3-ylmethyl)-1,4-diazepan-5-one.
| Compound Name | 1-(4-tert-butylbenzoyl)-4-(pyridin-3-ylmethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42484485 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-(4-tert-butylbenzoyl)-4-(pyridin-3-ylmethyl)-1,4-diazepan-5-one |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC(=O)N(Cc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-22(2,3)19-8-6-18(7-9-19)21(27)24-12-10-20(26)25(14-13-24)16-17-5-4-11-23-15-17/h4-9,11,15H,10,12-14,16H2,1-3H3 |
| InChIKey | BNDVJJSJKAQKMM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |