C17H18N2O2S — CID 26360657
4-benzyl-1-(thiophene-3-carbonyl)-1,4-diazepan-5-one (PubChem CID 26360657) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-benzyl-1-(thiophene-3-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 4-benzyl-1-(thiophene-3-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 26360657 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-benzyl-1-(thiophene-3-carbonyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2ccsc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C17H18N2O2S/c20-16-6-8-18(17(21)15-7-11-22-13-15)9-10-19(16)12-14-4-2-1-3-5-14/h1-5,7,11,13H,6,8-10,12H2 |
| InChIKey | ONGMFJRPFDYJBU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |